C20H31F3O3 — CID 150939705
1-(6,6,6-triethoxy-5-methylhexyl)-4-(trifluoromethyl)benzene (PubChem CID 150939705) has the molecular formula C20H31F3O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 1-(6,6,6-triethoxy-5-methylhexyl)-4-(trifluoromethyl)benzene.
| Compound Name | 1-(6,6,6-triethoxy-5-methylhexyl)-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 150939705 |
| Molecular Formula | C20H31F3O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 1-(6,6,6-triethoxy-5-methylhexyl)-4-(trifluoromethyl)benzene |
| SMILES | CCOC(OCC)(OCC)C(C)CCCCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H31F3O3/c1-5-24-20(25-6-2,26-7-3)16(4)10-8-9-11-17-12-14-18(15-13-17)19(21,22)23/h12-16H,5-11H2,1-4H3 |
| InChIKey | LHUAPQHYENUZJQ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|