C21H33F3O3 — CID 150840660
1,2,3-trifluoro-5-(8,8,8-triethoxy-7-methyloctyl)benzene (PubChem CID 150840660) has the molecular formula C21H33F3O3 and a molecular weight of 390.49 g/mol. Its IUPAC name is 1,2,3-trifluoro-5-(8,8,8-triethoxy-7-methyloctyl)benzene.
| Compound Name | 1,2,3-trifluoro-5-(8,8,8-triethoxy-7-methyloctyl)benzene |
|---|---|
| PubChem CID | 150840660 |
| Molecular Formula | C21H33F3O3 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 1,2,3-trifluoro-5-(8,8,8-triethoxy-7-methyloctyl)benzene |
| SMILES | CCOC(OCC)(OCC)C(C)CCCCCCc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C21H33F3O3/c1-5-25-21(26-6-2,27-7-3)16(4)12-10-8-9-11-13-17-14-18(22)20(24)19(23)15-17/h14-16H,5-13H2,1-4H3 |
| InChIKey | KNXLGHIWDXQZGU-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|