C20H33F3O3Si — CID 90172630
tri(propan-2-yloxy)-[5-(3,4,5-trifluorophenyl)pentyl]silane (PubChem CID 90172630) has the molecular formula C20H33F3O3Si and a molecular weight of 406.56 g/mol. Its IUPAC name is tri(propan-2-yloxy)-[5-(3,4,5-trifluorophenyl)pentyl]silane.
| Compound Name | tri(propan-2-yloxy)-[5-(3,4,5-trifluorophenyl)pentyl]silane |
|---|---|
| PubChem CID | 90172630 |
| Molecular Formula | C20H33F3O3Si |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | tri(propan-2-yloxy)-[5-(3,4,5-trifluorophenyl)pentyl]silane |
| SMILES | CC(C)O[Si](CCCCCc1cc(F)c(F)c(F)c1)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C20H33F3O3Si/c1-14(2)24-27(25-15(3)4,26-16(5)6)11-9-7-8-10-17-12-18(21)20(23)19(22)13-17/h12-16H,7-11H2,1-6H3 |
| InChIKey | ZZTVTLGUZFFSRB-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|