C19H31F3O3Si — CID 90173436
methoxy-di(propan-2-yloxy)-[6-(3,4,5-trifluorophenyl)hexyl]silane (PubChem CID 90173436) has the molecular formula C19H31F3O3Si and a molecular weight of 392.53 g/mol. Its IUPAC name is methoxy-di(propan-2-yloxy)-[6-(3,4,5-trifluorophenyl)hexyl]silane.
| Compound Name | methoxy-di(propan-2-yloxy)-[6-(3,4,5-trifluorophenyl)hexyl]silane |
|---|---|
| PubChem CID | 90173436 |
| Molecular Formula | C19H31F3O3Si |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | methoxy-di(propan-2-yloxy)-[6-(3,4,5-trifluorophenyl)hexyl]silane |
| SMILES | CO[Si](CCCCCCc1cc(F)c(F)c(F)c1)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C19H31F3O3Si/c1-14(2)24-26(23-5,25-15(3)4)11-9-7-6-8-10-16-12-17(20)19(22)18(21)13-16/h12-15H,6-11H2,1-5H3 |
| InChIKey | SSVFGZNTHODOAN-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|