C17H28F2O3Si — CID 90172610
6-(2,4-difluorophenyl)hexyl-dimethoxy-propan-2-yloxysilane (PubChem CID 90172610) has the molecular formula C17H28F2O3Si and a molecular weight of 346.49 g/mol. Its IUPAC name is 6-(2,4-difluorophenyl)hexyl-dimethoxy-propan-2-yloxysilane.
| Compound Name | 6-(2,4-difluorophenyl)hexyl-dimethoxy-propan-2-yloxysilane |
|---|---|
| PubChem CID | 90172610 |
| Molecular Formula | C17H28F2O3Si |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 6-(2,4-difluorophenyl)hexyl-dimethoxy-propan-2-yloxysilane |
| SMILES | CO[Si](CCCCCCc1ccc(F)cc1F)(OC)OC(C)C |
| InChI | InChI=1S/C17H28F2O3Si/c1-14(2)22-23(20-3,21-4)12-8-6-5-7-9-15-10-11-16(18)13-17(15)19/h10-11,13-14H,5-9,12H2,1-4H3 |
| InChIKey | TYJVXSLHTDZBLM-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|