C18H29F3O3Si — CID 90171416
tri(propan-2-yloxy)-[3-(2,4,5-trifluorophenyl)propyl]silane (PubChem CID 90171416) has the molecular formula C18H29F3O3Si and a molecular weight of 378.51 g/mol. Its IUPAC name is tri(propan-2-yloxy)-[3-(2,4,5-trifluorophenyl)propyl]silane.
| Compound Name | tri(propan-2-yloxy)-[3-(2,4,5-trifluorophenyl)propyl]silane |
|---|---|
| PubChem CID | 90171416 |
| Molecular Formula | C18H29F3O3Si |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | tri(propan-2-yloxy)-[3-(2,4,5-trifluorophenyl)propyl]silane |
| SMILES | CC(C)O[Si](CCCc1cc(F)c(F)cc1F)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C18H29F3O3Si/c1-12(2)22-25(23-13(3)4,24-14(5)6)9-7-8-15-10-17(20)18(21)11-16(15)19/h10-14H,7-9H2,1-6H3 |
| InChIKey | BKUIWHOFCCCQNM-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|