C15H24F2O2Si — CID 90172058
5-(2,4-difluorophenyl)pentyl-ethyl-dimethoxysilane (PubChem CID 90172058) has the molecular formula C15H24F2O2Si and a molecular weight of 302.44 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)pentyl-ethyl-dimethoxysilane.
| Compound Name | 5-(2,4-difluorophenyl)pentyl-ethyl-dimethoxysilane |
|---|---|
| PubChem CID | 90172058 |
| Molecular Formula | C15H24F2O2Si |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 5-(2,4-difluorophenyl)pentyl-ethyl-dimethoxysilane |
| SMILES | CC[Si](CCCCCc1ccc(F)cc1F)(OC)OC |
| InChI | InChI=1S/C15H24F2O2Si/c1-4-20(18-2,19-3)11-7-5-6-8-13-9-10-14(16)12-15(13)17/h9-10,12H,4-8,11H2,1-3H3 |
| InChIKey | POLIQTRTIHKMPO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|