C20H34F2O3Si — CID 90174590
5-(2,4-difluorophenyl)pentyl-tri(propan-2-yloxy)silane (PubChem CID 90174590) has the molecular formula C20H34F2O3Si and a molecular weight of 388.57 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)pentyl-tri(propan-2-yloxy)silane.
| Compound Name | 5-(2,4-difluorophenyl)pentyl-tri(propan-2-yloxy)silane |
|---|---|
| PubChem CID | 90174590 |
| Molecular Formula | C20H34F2O3Si |
| Molecular Weight | 388.57 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 5-(2,4-difluorophenyl)pentyl-tri(propan-2-yloxy)silane |
| SMILES | CC(C)O[Si](CCCCCc1ccc(F)cc1F)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C20H34F2O3Si/c1-15(2)23-26(24-16(3)4,25-17(5)6)13-9-7-8-10-18-11-12-19(21)14-20(18)22/h11-12,14-17H,7-10,13H2,1-6H3 |
| InChIKey | XEPNQRCOVOSIBF-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.57 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|