C11H14F2O — CID 64516740
5-(2,4-difluorophenyl)pentan-2-ol (PubChem CID 64516740) has the molecular formula C11H14F2O and a molecular weight of 200.23 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)pentan-2-ol.
| Compound Name | 5-(2,4-difluorophenyl)pentan-2-ol |
|---|---|
| PubChem CID | 64516740 |
| Molecular Formula | C11H14F2O |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 5-(2,4-difluorophenyl)pentan-2-ol |
| SMILES | CC(O)CCCc1ccc(F)cc1F |
| InChI | InChI=1S/C11H14F2O/c1-8(14)3-2-4-9-5-6-10(12)7-11(9)13/h5-8,14H,2-4H2,1H3 |
| InChIKey | FCSOGUOSXZDYDN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |