C13H18F2O — CID 62197542
1-(2,4-difluorophenyl)-4,4-dimethylpentan-3-ol (PubChem CID 62197542) has the molecular formula C13H18F2O and a molecular weight of 228.28 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-4,4-dimethylpentan-3-ol.
| Compound Name | 1-(2,4-difluorophenyl)-4,4-dimethylpentan-3-ol |
|---|---|
| PubChem CID | 62197542 |
| Molecular Formula | C13H18F2O |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 1-(2,4-difluorophenyl)-4,4-dimethylpentan-3-ol |
| SMILES | CC(C)(C)C(O)CCc1ccc(F)cc1F |
| InChI | InChI=1S/C13H18F2O/c1-13(2,3)12(16)7-5-9-4-6-10(14)8-11(9)15/h4,6,8,12,16H,5,7H2,1-3H3 |
| InChIKey | RYXJJKYOMFYDET-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |