C15H21F2N — CID 113390146
1-cyclopentyl-3-(2,4-difluorophenyl)-N-methylpropan-1-amine (PubChem CID 113390146) has the molecular formula C15H21F2N and a molecular weight of 253.34 g/mol. Its IUPAC name is 1-cyclopentyl-3-(2,4-difluorophenyl)-N-methylpropan-1-amine.
| Compound Name | 1-cyclopentyl-3-(2,4-difluorophenyl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 113390146 |
| Molecular Formula | C15H21F2N |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 1-cyclopentyl-3-(2,4-difluorophenyl)-N-methylpropan-1-amine |
| SMILES | CNC(CCc1ccc(F)cc1F)C1CCCC1 |
| InChI | InChI=1S/C15H21F2N/c1-18-15(12-4-2-3-5-12)9-7-11-6-8-13(16)10-14(11)17/h6,8,10,12,15,18H,2-5,7,9H2,1H3 |
| InChIKey | FAKLRHUCCHJHSL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |