C14H18F2O — CID 62195897
1-cyclohexyl-2-(2,4-difluorophenyl)ethanol (PubChem CID 62195897) has the molecular formula C14H18F2O and a molecular weight of 240.29 g/mol. Its IUPAC name is 1-cyclohexyl-2-(2,4-difluorophenyl)ethanol.
| Compound Name | 1-cyclohexyl-2-(2,4-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 62195897 |
| Molecular Formula | C14H18F2O |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 1-cyclohexyl-2-(2,4-difluorophenyl)ethanol |
| SMILES | OC(Cc1ccc(F)cc1F)C1CCCCC1 |
| InChI | InChI=1S/C14H18F2O/c15-12-7-6-11(13(16)9-12)8-14(17)10-4-2-1-3-5-10/h6-7,9-10,14,17H,1-5,8H2 |
| InChIKey | NWGMFDXKZQRABY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |