C13H15BrF2 — CID 103166568
1-(2-bromo-3-cyclobutylpropyl)-2,4-difluorobenzene (PubChem CID 103166568) has the molecular formula C13H15BrF2 and a molecular weight of 289.16 g/mol. Its IUPAC name is 1-(2-bromo-3-cyclobutylpropyl)-2,4-difluorobenzene.
| Compound Name | 1-(2-bromo-3-cyclobutylpropyl)-2,4-difluorobenzene |
|---|---|
| PubChem CID | 103166568 |
| Molecular Formula | C13H15BrF2 |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 1-(2-bromo-3-cyclobutylpropyl)-2,4-difluorobenzene |
| SMILES | Fc1ccc(CC(Br)CC2CCC2)c(F)c1 |
| InChI | InChI=1S/C13H15BrF2/c14-11(6-9-2-1-3-9)7-10-4-5-12(15)8-13(10)16/h4-5,8-9,11H,1-3,6-7H2 |
| InChIKey | HFWUEZAGYUBICW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|