C16H24F2N2 — CID 105291836
[4-cyclohexyl-1-(2,4-difluorophenyl)butan-2-yl]hydrazine (PubChem CID 105291836) has the molecular formula C16H24F2N2 and a molecular weight of 282.38 g/mol. Its IUPAC name is [4-cyclohexyl-1-(2,4-difluorophenyl)butan-2-yl]hydrazine.
| Compound Name | [4-cyclohexyl-1-(2,4-difluorophenyl)butan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105291836 |
| Molecular Formula | C16H24F2N2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | [4-cyclohexyl-1-(2,4-difluorophenyl)butan-2-yl]hydrazine |
| SMILES | NNC(CCC1CCCCC1)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C16H24F2N2/c17-14-8-7-13(16(18)11-14)10-15(20-19)9-6-12-4-2-1-3-5-12/h7-8,11-12,15,20H,1-6,9-10,19H2 |
| InChIKey | YYZSVZACMIMKNO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|