C18H27F2N — CID 115809797
4-cyclopentyl-1-(2,5-difluorophenyl)-N-propylbutan-2-amine (PubChem CID 115809797) has the molecular formula C18H27F2N and a molecular weight of 295.42 g/mol. Its IUPAC name is 4-cyclopentyl-1-(2,5-difluorophenyl)-N-propylbutan-2-amine.
| Compound Name | 4-cyclopentyl-1-(2,5-difluorophenyl)-N-propylbutan-2-amine |
|---|---|
| PubChem CID | 115809797 |
| Molecular Formula | C18H27F2N |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 4-cyclopentyl-1-(2,5-difluorophenyl)-N-propylbutan-2-amine |
| SMILES | CCCNC(CCC1CCCC1)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C18H27F2N/c1-2-11-21-17(9-7-14-5-3-4-6-14)13-15-12-16(19)8-10-18(15)20/h8,10,12,14,17,21H,2-7,9,11,13H2,1H3 |
| InChIKey | IMJOUYCWZSMEAW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |