C17H25F2NS — CID 105105020
1-(2,5-difluorophenyl)-N-propyl-3-(thian-4-yl)propan-2-amine (PubChem CID 105105020) has the molecular formula C17H25F2NS and a molecular weight of 313.46 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-N-propyl-3-(thian-4-yl)propan-2-amine.
| Compound Name | 1-(2,5-difluorophenyl)-N-propyl-3-(thian-4-yl)propan-2-amine |
|---|---|
| PubChem CID | 105105020 |
| Molecular Formula | C17H25F2NS |
| Molecular Weight | 313.46 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 1-(2,5-difluorophenyl)-N-propyl-3-(thian-4-yl)propan-2-amine |
| SMILES | CCCNC(Cc1cc(F)ccc1F)CC1CCSCC1 |
| InChI | InChI=1S/C17H25F2NS/c1-2-7-20-16(10-13-5-8-21-9-6-13)12-14-11-15(18)3-4-17(14)19/h3-4,11,13,16,20H,2,5-10,12H2,1H3 |
| InChIKey | YYSJYFTUPLRLFV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |