C17H25F2NS — CID 105412607
1-(3,5-difluorophenyl)-N-propyl-3-(thian-4-yl)propan-2-amine (PubChem CID 105412607) has the molecular formula C17H25F2NS and a molecular weight of 313.46 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-N-propyl-3-(thian-4-yl)propan-2-amine.
| Compound Name | 1-(3,5-difluorophenyl)-N-propyl-3-(thian-4-yl)propan-2-amine |
|---|---|
| PubChem CID | 105412607 |
| Molecular Formula | C17H25F2NS |
| Molecular Weight | 313.46 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 1-(3,5-difluorophenyl)-N-propyl-3-(thian-4-yl)propan-2-amine |
| SMILES | CCCNC(Cc1cc(F)cc(F)c1)CC1CCSCC1 |
| InChI | InChI=1S/C17H25F2NS/c1-2-5-20-17(10-13-3-6-21-7-4-13)11-14-8-15(18)12-16(19)9-14/h8-9,12-13,17,20H,2-7,10-11H2,1H3 |
| InChIKey | AOGXKGUJKIAFIY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |