C16H23F2N — CID 66039224
1-(3,5-difluorophenyl)-4-methylidene-N-propylhexan-2-amine (PubChem CID 66039224) has the molecular formula C16H23F2N and a molecular weight of 267.36 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-4-methylidene-N-propylhexan-2-amine.
| Compound Name | 1-(3,5-difluorophenyl)-4-methylidene-N-propylhexan-2-amine |
|---|---|
| PubChem CID | 66039224 |
| Molecular Formula | C16H23F2N |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 1-(3,5-difluorophenyl)-4-methylidene-N-propylhexan-2-amine |
| SMILES | C=C(CC)CC(Cc1cc(F)cc(F)c1)NCCC |
| InChI | InChI=1S/C16H23F2N/c1-4-6-19-16(7-12(3)5-2)10-13-8-14(17)11-15(18)9-13/h8-9,11,16,19H,3-7,10H2,1-2H3 |
| InChIKey | GFGWOGIEVOAZCU-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|