C17H25F2NO — CID 115846981
1-(3,4-difluorophenyl)-3-(oxan-4-yl)-N-propylpropan-2-amine (PubChem CID 115846981) has the molecular formula C17H25F2NO and a molecular weight of 297.39 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-(oxan-4-yl)-N-propylpropan-2-amine.
| Compound Name | 1-(3,4-difluorophenyl)-3-(oxan-4-yl)-N-propylpropan-2-amine |
|---|---|
| PubChem CID | 115846981 |
| Molecular Formula | C17H25F2NO |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-(oxan-4-yl)-N-propylpropan-2-amine |
| SMILES | CCCNC(Cc1ccc(F)c(F)c1)CC1CCOCC1 |
| InChI | InChI=1S/C17H25F2NO/c1-2-7-20-15(10-13-5-8-21-9-6-13)11-14-3-4-16(18)17(19)12-14/h3-4,12-13,15,20H,2,5-11H2,1H3 |
| InChIKey | TYLVTOPUDJUTTE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |