C14H21F2NO — CID 82922348
1-(3,4-difluorophenyl)-3-ethoxy-N-propylpropan-2-amine (PubChem CID 82922348) has the molecular formula C14H21F2NO and a molecular weight of 257.32 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-ethoxy-N-propylpropan-2-amine.
| Compound Name | 1-(3,4-difluorophenyl)-3-ethoxy-N-propylpropan-2-amine |
|---|---|
| PubChem CID | 82922348 |
| Molecular Formula | C14H21F2NO |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-ethoxy-N-propylpropan-2-amine |
| SMILES | CCCNC(COCC)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H21F2NO/c1-3-7-17-12(10-18-4-2)8-11-5-6-13(15)14(16)9-11/h5-6,9,12,17H,3-4,7-8,10H2,1-2H3 |
| InChIKey | RFXLLYKIPFEEDA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |