C17H27F2N — CID 105028359
1-(3,4-difluorophenyl)-4-ethyl-N-propylhexan-2-amine (PubChem CID 105028359) has the molecular formula C17H27F2N and a molecular weight of 283.41 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-4-ethyl-N-propylhexan-2-amine.
| Compound Name | 1-(3,4-difluorophenyl)-4-ethyl-N-propylhexan-2-amine |
|---|---|
| PubChem CID | 105028359 |
| Molecular Formula | C17H27F2N |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | 1-(3,4-difluorophenyl)-4-ethyl-N-propylhexan-2-amine |
| SMILES | CCCNC(Cc1ccc(F)c(F)c1)CC(CC)CC |
| InChI | InChI=1S/C17H27F2N/c1-4-9-20-15(10-13(5-2)6-3)11-14-7-8-16(18)17(19)12-14/h7-8,12-13,15,20H,4-6,9-11H2,1-3H3 |
| InChIKey | OBAXWLUDBKGZKT-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |