C16H26F2N2 — CID 105288434
[1-(3,4-difluorophenyl)-4-ethyloctan-2-yl]hydrazine (PubChem CID 105288434) has the molecular formula C16H26F2N2 and a molecular weight of 284.39 g/mol. Its IUPAC name is [1-(3,4-difluorophenyl)-4-ethyloctan-2-yl]hydrazine.
| Compound Name | [1-(3,4-difluorophenyl)-4-ethyloctan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105288434 |
| Molecular Formula | C16H26F2N2 |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | [1-(3,4-difluorophenyl)-4-ethyloctan-2-yl]hydrazine |
| SMILES | CCCCC(CC)CC(Cc1ccc(F)c(F)c1)NN |
| InChI | InChI=1S/C16H26F2N2/c1-3-5-6-12(4-2)9-14(20-19)10-13-7-8-15(17)16(18)11-13/h7-8,11-12,14,20H,3-6,9-10,19H2,1-2H3 |
| InChIKey | ZMGIXWMXTWKPAE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|