C14H22F2N2 — CID 105294121
1-(3,4-difluorophenyl)octan-2-ylhydrazine (PubChem CID 105294121) has the molecular formula C14H22F2N2 and a molecular weight of 256.34 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)octan-2-ylhydrazine.
| Compound Name | 1-(3,4-difluorophenyl)octan-2-ylhydrazine |
|---|---|
| PubChem CID | 105294121 |
| Molecular Formula | C14H22F2N2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 1-(3,4-difluorophenyl)octan-2-ylhydrazine |
| SMILES | CCCCCCC(Cc1ccc(F)c(F)c1)NN |
| InChI | InChI=1S/C14H22F2N2/c1-2-3-4-5-6-12(18-17)9-11-7-8-13(15)14(16)10-11/h7-8,10,12,18H,2-6,9,17H2,1H3 |
| InChIKey | LMPRDKYBGOTVJE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|