C11H16F2N2S — CID 105330380
[1-(3,4-difluorophenyl)-4-methylsulfanylbutan-2-yl]hydrazine (PubChem CID 105330380) has the molecular formula C11H16F2N2S and a molecular weight of 246.33 g/mol. Its IUPAC name is [1-(3,4-difluorophenyl)-4-methylsulfanylbutan-2-yl]hydrazine.
| Compound Name | [1-(3,4-difluorophenyl)-4-methylsulfanylbutan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105330380 |
| Molecular Formula | C11H16F2N2S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | [1-(3,4-difluorophenyl)-4-methylsulfanylbutan-2-yl]hydrazine |
| SMILES | CSCCC(Cc1ccc(F)c(F)c1)NN |
| InChI | InChI=1S/C11H16F2N2S/c1-16-5-4-9(15-14)6-8-2-3-10(12)11(13)7-8/h2-3,7,9,15H,4-6,14H2,1H3 |
| InChIKey | QASYKMWZSIAPCJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|