C12H17BrFNS — CID 105111701
1-(3-bromo-4-fluorophenyl)-N-methyl-4-methylsulfanylbutan-2-amine (PubChem CID 105111701) has the molecular formula C12H17BrFNS and a molecular weight of 306.24 g/mol. Its IUPAC name is 1-(3-bromo-4-fluorophenyl)-N-methyl-4-methylsulfanylbutan-2-amine.
| Compound Name | 1-(3-bromo-4-fluorophenyl)-N-methyl-4-methylsulfanylbutan-2-amine |
|---|---|
| PubChem CID | 105111701 |
| Molecular Formula | C12H17BrFNS |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 1-(3-bromo-4-fluorophenyl)-N-methyl-4-methylsulfanylbutan-2-amine |
| SMILES | CNC(CCSC)Cc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C12H17BrFNS/c1-15-10(5-6-16-2)7-9-3-4-12(14)11(13)8-9/h3-4,8,10,15H,5-7H2,1-2H3 |
| InChIKey | KXPGGBOEVFXFLU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |