C11H14BrFOS — CID 63901398
1-(3-bromo-4-fluorophenyl)-4-methylsulfanylbutan-2-ol (PubChem CID 63901398) has the molecular formula C11H14BrFOS and a molecular weight of 293.20 g/mol. Its IUPAC name is 1-(3-bromo-4-fluorophenyl)-4-methylsulfanylbutan-2-ol.
| Compound Name | 1-(3-bromo-4-fluorophenyl)-4-methylsulfanylbutan-2-ol |
|---|---|
| PubChem CID | 63901398 |
| Molecular Formula | C11H14BrFOS |
| Molecular Weight | 293.20 g/mol |
| Exact Mass | 291.99 |
| IUPAC Name | 1-(3-bromo-4-fluorophenyl)-4-methylsulfanylbutan-2-ol |
| SMILES | CSCCC(O)Cc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C11H14BrFOS/c1-15-5-4-9(14)6-8-2-3-11(13)10(12)7-8/h2-3,7,9,14H,4-6H2,1H3 |
| InChIKey | IVSYEXWFJRDQKF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.20 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |