C11H11BrF4O — CID 79954757
1-(3-bromo-4-fluorophenyl)-5,5,5-trifluoropentan-2-ol (PubChem CID 79954757) has the molecular formula C11H11BrF4O and a molecular weight of 315.10 g/mol. Its IUPAC name is 1-(3-bromo-4-fluorophenyl)-5,5,5-trifluoropentan-2-ol.
| Compound Name | 1-(3-bromo-4-fluorophenyl)-5,5,5-trifluoropentan-2-ol |
|---|---|
| PubChem CID | 79954757 |
| Molecular Formula | C11H11BrF4O |
| Molecular Weight | 315.10 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | 1-(3-bromo-4-fluorophenyl)-5,5,5-trifluoropentan-2-ol |
| SMILES | OC(CCC(F)(F)F)Cc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C11H11BrF4O/c12-9-6-7(1-2-10(9)13)5-8(17)3-4-11(14,15)16/h1-2,6,8,17H,3-5H2 |
| InChIKey | OBQYICAEPRTCMA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.10 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |