C11H11F5O — CID 79954433
1-(2,5-difluorophenyl)-5,5,5-trifluoropentan-2-ol (PubChem CID 79954433) has the molecular formula C11H11F5O and a molecular weight of 254.20 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-5,5,5-trifluoropentan-2-ol.
| Compound Name | 1-(2,5-difluorophenyl)-5,5,5-trifluoropentan-2-ol |
|---|---|
| PubChem CID | 79954433 |
| Molecular Formula | C11H11F5O |
| Molecular Weight | 254.20 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 1-(2,5-difluorophenyl)-5,5,5-trifluoropentan-2-ol |
| SMILES | OC(CCC(F)(F)F)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C11H11F5O/c12-8-1-2-10(13)7(5-8)6-9(17)3-4-11(14,15)16/h1-2,5,9,17H,3-4,6H2 |
| InChIKey | AIQKOQIWQGMVKY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.20 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |