C12H14F2O3 — CID 103547378
1-(2,5-difluorophenyl)-3-(1,3-dioxolan-2-yl)propan-2-ol (PubChem CID 103547378) has the molecular formula C12H14F2O3 and a molecular weight of 244.24 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-3-(1,3-dioxolan-2-yl)propan-2-ol.
| Compound Name | 1-(2,5-difluorophenyl)-3-(1,3-dioxolan-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 103547378 |
| Molecular Formula | C12H14F2O3 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 1-(2,5-difluorophenyl)-3-(1,3-dioxolan-2-yl)propan-2-ol |
| SMILES | OC(Cc1cc(F)ccc1F)CC1OCCO1 |
| InChI | InChI=1S/C12H14F2O3/c13-9-1-2-11(14)8(5-9)6-10(15)7-12-16-3-4-17-12/h1-2,5,10,12,15H,3-4,6-7H2 |
| InChIKey | ALBOPPHXRNNPLZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |