C12H15F2NO2 — CID 65350986
2-(2,5-difluorophenyl)-1-(1,4-dioxan-2-yl)ethanamine (PubChem CID 65350986) has the molecular formula C12H15F2NO2 and a molecular weight of 243.25 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-1-(1,4-dioxan-2-yl)ethanamine.
| Compound Name | 2-(2,5-difluorophenyl)-1-(1,4-dioxan-2-yl)ethanamine |
|---|---|
| PubChem CID | 65350986 |
| Molecular Formula | C12H15F2NO2 |
| Molecular Weight | 243.25 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 2-(2,5-difluorophenyl)-1-(1,4-dioxan-2-yl)ethanamine |
| SMILES | NC(Cc1cc(F)ccc1F)C1COCCO1 |
| InChI | InChI=1S/C12H15F2NO2/c13-9-1-2-10(14)8(5-9)6-11(15)12-7-16-3-4-17-12/h1-2,5,11-12H,3-4,6-7,15H2 |
| InChIKey | YCWMIFNPDZPCCW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |