C12H15Cl2NO2 — CID 107312027
2-(2,3-dichlorophenyl)-1-(1,4-dioxan-2-yl)ethanamine (PubChem CID 107312027) has the molecular formula C12H15Cl2NO2 and a molecular weight of 276.16 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)-1-(1,4-dioxan-2-yl)ethanamine.
| Compound Name | 2-(2,3-dichlorophenyl)-1-(1,4-dioxan-2-yl)ethanamine |
|---|---|
| PubChem CID | 107312027 |
| Molecular Formula | C12H15Cl2NO2 |
| Molecular Weight | 276.16 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 2-(2,3-dichlorophenyl)-1-(1,4-dioxan-2-yl)ethanamine |
| SMILES | NC(Cc1cccc(Cl)c1Cl)C1COCCO1 |
| InChI | InChI=1S/C12H15Cl2NO2/c13-9-3-1-2-8(12(9)14)6-10(15)11-7-16-4-5-17-11/h1-3,10-11H,4-7,15H2 |
| InChIKey | XHZSYHDTNTXIKL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.16 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |