C11H13Cl2N — CID 107308371
1-cyclopropyl-2-(2,3-dichlorophenyl)ethanamine (PubChem CID 107308371) has the molecular formula C11H13Cl2N and a molecular weight of 230.14 g/mol. Its IUPAC name is 1-cyclopropyl-2-(2,3-dichlorophenyl)ethanamine.
| Compound Name | 1-cyclopropyl-2-(2,3-dichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 107308371 |
| Molecular Formula | C11H13Cl2N |
| Molecular Weight | 230.14 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 1-cyclopropyl-2-(2,3-dichlorophenyl)ethanamine |
| SMILES | NC(Cc1cccc(Cl)c1Cl)C1CC1 |
| InChI | InChI=1S/C11H13Cl2N/c12-9-3-1-2-8(11(9)13)6-10(14)7-4-5-7/h1-3,7,10H,4-6,14H2 |
| InChIKey | ALZXOKGQCJIGGU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.14 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |