C14H18Cl2OS — CID 107312531
1-(2,3-dichlorophenyl)-3-(thian-4-yl)propan-2-ol (PubChem CID 107312531) has the molecular formula C14H18Cl2OS and a molecular weight of 305.27 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-3-(thian-4-yl)propan-2-ol.
| Compound Name | 1-(2,3-dichlorophenyl)-3-(thian-4-yl)propan-2-ol |
|---|---|
| PubChem CID | 107312531 |
| Molecular Formula | C14H18Cl2OS |
| Molecular Weight | 305.27 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-3-(thian-4-yl)propan-2-ol |
| SMILES | OC(Cc1cccc(Cl)c1Cl)CC1CCSCC1 |
| InChI | InChI=1S/C14H18Cl2OS/c15-13-3-1-2-11(14(13)16)9-12(17)8-10-4-6-18-7-5-10/h1-3,10,12,17H,4-9H2 |
| InChIKey | GUTKWMVDFLEJMT-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.27 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |