C15H21Cl2NS — CID 107312279
N-[2-(2,3-dichlorophenyl)-1-(thiolan-3-yl)ethyl]propan-1-amine (PubChem CID 107312279) has the molecular formula C15H21Cl2NS and a molecular weight of 318.31 g/mol. Its IUPAC name is N-[2-(2,3-dichlorophenyl)-1-(thiolan-3-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-(2,3-dichlorophenyl)-1-(thiolan-3-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 107312279 |
| Molecular Formula | C15H21Cl2NS |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | N-[2-(2,3-dichlorophenyl)-1-(thiolan-3-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1cccc(Cl)c1Cl)C1CCSC1 |
| InChI | InChI=1S/C15H21Cl2NS/c1-2-7-18-14(12-6-8-19-10-12)9-11-4-3-5-13(16)15(11)17/h3-5,12,14,18H,2,6-10H2,1H3 |
| InChIKey | MQIDPXPBWKCUJV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |