C13H16Cl2F3N — CID 107308478
1-(2,3-dichlorophenyl)-4,4,4-trifluoro-N-propylbutan-2-amine (PubChem CID 107308478) has the molecular formula C13H16Cl2F3N and a molecular weight of 314.18 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-4,4,4-trifluoro-N-propylbutan-2-amine.
| Compound Name | 1-(2,3-dichlorophenyl)-4,4,4-trifluoro-N-propylbutan-2-amine |
|---|---|
| PubChem CID | 107308478 |
| Molecular Formula | C13H16Cl2F3N |
| Molecular Weight | 314.18 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-4,4,4-trifluoro-N-propylbutan-2-amine |
| SMILES | CCCNC(Cc1cccc(Cl)c1Cl)CC(F)(F)F |
| InChI | InChI=1S/C13H16Cl2F3N/c1-2-6-19-10(8-13(16,17)18)7-9-4-3-5-11(14)12(9)15/h3-5,10,19H,2,6-8H2,1H3 |
| InChIKey | VNQDFJIXZFEHJA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.18 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |