C16H25Cl2NO — CID 107309099
1-(2,3-dichlorophenyl)-3-ethoxy-3-methyl-N-propylbutan-2-amine (PubChem CID 107309099) has the molecular formula C16H25Cl2NO and a molecular weight of 318.29 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-3-ethoxy-3-methyl-N-propylbutan-2-amine.
| Compound Name | 1-(2,3-dichlorophenyl)-3-ethoxy-3-methyl-N-propylbutan-2-amine |
|---|---|
| PubChem CID | 107309099 |
| Molecular Formula | C16H25Cl2NO |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-3-ethoxy-3-methyl-N-propylbutan-2-amine |
| SMILES | CCCNC(Cc1cccc(Cl)c1Cl)C(C)(C)OCC |
| InChI | InChI=1S/C16H25Cl2NO/c1-5-10-19-14(16(3,4)20-6-2)11-12-8-7-9-13(17)15(12)18/h7-9,14,19H,5-6,10-11H2,1-4H3 |
| InChIKey | LSHCKXZGNACUID-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |