C17H27ClFNO — CID 102857999
1-(3-chloro-2-fluorophenyl)-3-ethoxy-3-methyl-N-propylpentan-2-amine (PubChem CID 102857999) has the molecular formula C17H27ClFNO and a molecular weight of 315.86 g/mol. Its IUPAC name is 1-(3-chloro-2-fluorophenyl)-3-ethoxy-3-methyl-N-propylpentan-2-amine.
| Compound Name | 1-(3-chloro-2-fluorophenyl)-3-ethoxy-3-methyl-N-propylpentan-2-amine |
|---|---|
| PubChem CID | 102857999 |
| Molecular Formula | C17H27ClFNO |
| Molecular Weight | 315.86 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 1-(3-chloro-2-fluorophenyl)-3-ethoxy-3-methyl-N-propylpentan-2-amine |
| SMILES | CCCNC(Cc1cccc(Cl)c1F)C(C)(CC)OCC |
| InChI | InChI=1S/C17H27ClFNO/c1-5-11-20-15(17(4,6-2)21-7-3)12-13-9-8-10-14(18)16(13)19/h8-10,15,20H,5-7,11-12H2,1-4H3 |
| InChIKey | HSBGEYAURTUPCK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.86 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |