C12H14Cl2F3N — CID 107312354
3-(2,3-dichlorophenyl)-1,1,1-trifluoro-N-propylpropan-2-amine (PubChem CID 107312354) has the molecular formula C12H14Cl2F3N and a molecular weight of 300.15 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-1,1,1-trifluoro-N-propylpropan-2-amine.
| Compound Name | 3-(2,3-dichlorophenyl)-1,1,1-trifluoro-N-propylpropan-2-amine |
|---|---|
| PubChem CID | 107312354 |
| Molecular Formula | C12H14Cl2F3N |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 3-(2,3-dichlorophenyl)-1,1,1-trifluoro-N-propylpropan-2-amine |
| SMILES | CCCNC(Cc1cccc(Cl)c1Cl)C(F)(F)F |
| InChI | InChI=1S/C12H14Cl2F3N/c1-2-6-18-10(12(15,16)17)7-8-4-3-5-9(13)11(8)14/h3-5,10,18H,2,6-7H2,1H3 |
| InChIKey | AXYSIUZQPJULSZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |