C13H21NOS — CID 105177672
N-[2-(furan-3-yl)-1-(thiolan-3-yl)ethyl]propan-1-amine (PubChem CID 105177672) has the molecular formula C13H21NOS and a molecular weight of 239.38 g/mol. Its IUPAC name is N-[2-(furan-3-yl)-1-(thiolan-3-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-(furan-3-yl)-1-(thiolan-3-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 105177672 |
| Molecular Formula | C13H21NOS |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | N-[2-(furan-3-yl)-1-(thiolan-3-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccoc1)C1CCSC1 |
| InChI | InChI=1S/C13H21NOS/c1-2-5-14-13(12-4-7-16-10-12)8-11-3-6-15-9-11/h3,6,9,12-14H,2,4-5,7-8,10H2,1H3 |
| InChIKey | LRSMTTMOIJHKMD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |