C13H21NO2S — CID 83182561
N-[2-(furan-3-yl)-1-(1,4-oxathian-2-yl)ethyl]propan-1-amine (PubChem CID 83182561) has the molecular formula C13H21NO2S and a molecular weight of 255.38 g/mol. Its IUPAC name is N-[2-(furan-3-yl)-1-(1,4-oxathian-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-(furan-3-yl)-1-(1,4-oxathian-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 83182561 |
| Molecular Formula | C13H21NO2S |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | N-[2-(furan-3-yl)-1-(1,4-oxathian-2-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccoc1)C1CSCCO1 |
| InChI | InChI=1S/C13H21NO2S/c1-2-4-14-12(8-11-3-5-15-9-11)13-10-17-7-6-16-13/h3,5,9,12-14H,2,4,6-8,10H2,1H3 |
| InChIKey | LMKODKCJXYRKDU-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |