C13H27NOS — CID 79962761
4-methyl-1-(1,4-oxathian-2-yl)-N-propylpentan-1-amine (PubChem CID 79962761) has the molecular formula C13H27NOS and a molecular weight of 245.43 g/mol. Its IUPAC name is 4-methyl-1-(1,4-oxathian-2-yl)-N-propylpentan-1-amine.
| Compound Name | 4-methyl-1-(1,4-oxathian-2-yl)-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 79962761 |
| Molecular Formula | C13H27NOS |
| Molecular Weight | 245.43 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 4-methyl-1-(1,4-oxathian-2-yl)-N-propylpentan-1-amine |
| SMILES | CCCNC(CCC(C)C)C1CSCCO1 |
| InChI | InChI=1S/C13H27NOS/c1-4-7-14-12(6-5-11(2)3)13-10-16-9-8-15-13/h11-14H,4-10H2,1-3H3 |
| InChIKey | IGLAMBCQMRCBGS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |