C11H24N2OS — CID 105249713
1-(1,4-oxathian-2-yl)heptylhydrazine (PubChem CID 105249713) has the molecular formula C11H24N2OS and a molecular weight of 232.39 g/mol. Its IUPAC name is 1-(1,4-oxathian-2-yl)heptylhydrazine.
| Compound Name | 1-(1,4-oxathian-2-yl)heptylhydrazine |
|---|---|
| PubChem CID | 105249713 |
| Molecular Formula | C11H24N2OS |
| Molecular Weight | 232.39 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 1-(1,4-oxathian-2-yl)heptylhydrazine |
| SMILES | CCCCCCC(NN)C1CSCCO1 |
| InChI | InChI=1S/C11H24N2OS/c1-2-3-4-5-6-10(13-12)11-9-15-8-7-14-11/h10-11,13H,2-9,12H2,1H3 |
| InChIKey | JALUGQSEIMDOSL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|