C9H18N2OS — CID 105249626
1-(1,4-oxathian-2-yl)pent-4-enylhydrazine (PubChem CID 105249626) has the molecular formula C9H18N2OS and a molecular weight of 202.32 g/mol. Its IUPAC name is 1-(1,4-oxathian-2-yl)pent-4-enylhydrazine.
| Compound Name | 1-(1,4-oxathian-2-yl)pent-4-enylhydrazine |
|---|---|
| PubChem CID | 105249626 |
| Molecular Formula | C9H18N2OS |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 1-(1,4-oxathian-2-yl)pent-4-enylhydrazine |
| SMILES | C=CCCC(NN)C1CSCCO1 |
| InChI | InChI=1S/C9H18N2OS/c1-2-3-4-8(11-10)9-7-13-6-5-12-9/h2,8-9,11H,1,3-7,10H2 |
| InChIKey | XKCFIMOPGXWVOA-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|