C12H18N2OS — CID 105249482
[1-(1,4-oxathian-2-yl)-2-phenylethyl]hydrazine (PubChem CID 105249482) has the molecular formula C12H18N2OS and a molecular weight of 238.36 g/mol. Its IUPAC name is [1-(1,4-oxathian-2-yl)-2-phenylethyl]hydrazine.
| Compound Name | [1-(1,4-oxathian-2-yl)-2-phenylethyl]hydrazine |
|---|---|
| PubChem CID | 105249482 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | [1-(1,4-oxathian-2-yl)-2-phenylethyl]hydrazine |
| SMILES | NNC(Cc1ccccc1)C1CSCCO1 |
| InChI | InChI=1S/C12H18N2OS/c13-14-11(12-9-16-7-6-15-12)8-10-4-2-1-3-5-10/h1-5,11-12,14H,6-9,13H2 |
| InChIKey | CAYKKPDYUSHKRP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|