C7H16N2OS — CID 105249656
1-(1,4-oxathian-2-yl)propylhydrazine (PubChem CID 105249656) has the molecular formula C7H16N2OS and a molecular weight of 176.28 g/mol. Its IUPAC name is 1-(1,4-oxathian-2-yl)propylhydrazine.
| Compound Name | 1-(1,4-oxathian-2-yl)propylhydrazine |
|---|---|
| PubChem CID | 105249656 |
| Molecular Formula | C7H16N2OS |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 1-(1,4-oxathian-2-yl)propylhydrazine |
| SMILES | CCC(NN)C1CSCCO1 |
| InChI | InChI=1S/C7H16N2OS/c1-2-6(9-8)7-5-11-4-3-10-7/h6-7,9H,2-5,8H2,1H3 |
| InChIKey | OLPWHXZCLILMEA-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|