C7H15NOS — CID 104932260
(1S)-1-(1,4-oxathian-2-yl)propan-1-amine (PubChem CID 104932260) has the molecular formula C7H15NOS and a molecular weight of 161.27 g/mol. Its IUPAC name is (1S)-1-(1,4-oxathian-2-yl)propan-1-amine.
| Compound Name | (1S)-1-(1,4-oxathian-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 104932260 |
| Molecular Formula | C7H15NOS |
| Molecular Weight | 161.27 g/mol |
| Exact Mass | 161.09 |
| IUPAC Name | (1S)-1-(1,4-oxathian-2-yl)propan-1-amine |
| SMILES | CC[C@H](N)C1CSCCO1 |
| InChI | InChI=1S/C7H15NOS/c1-2-6(8)7-5-10-4-3-9-7/h6-7H,2-5,8H2,1H3/t6-,7?/m0/s1 |
| InChIKey | XZKXOJHJUCWQHF-PKPIPKONSA-N |
| XLogP | 0.86 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.27 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |