About N,3-diethyl-1-(1,4-oxathian-2-yl)pentan-1-amine
N,3-diethyl-1-(1,4-oxathian-2-yl)pentan-1-amine (PubChem CID 82922082) has the molecular formula C13H27NOS
and a molecular weight of 245.43 g/mol. Its IUPAC name is N,3-diethyl-1-(1,4-oxathian-2-yl)pentan-1-amine.
Molecular Properties
| Compound Name | N,3-diethyl-1-(1,4-oxathian-2-yl)pentan-1-amine |
| PubChem CID | 82922082 |
| Molecular Formula | C13H27NOS |
| Molecular Weight | 245.43 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | N,3-diethyl-1-(1,4-oxathian-2-yl)pentan-1-amine |
| SMILES | CCNC(CC(CC)CC)C1CSCCO1 |
| InChI | InChI=1S/C13H27NOS/c1-4-11(5-2)9-12(14-6-3)13-10-16-8-7-15-13/h11-14H,4-10H2,1-3H3 |
| InChIKey | HODVPYCFCCBFJW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,3-diethyl-1-(1,4-oxathian-2-yl)pentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,3-diethyl-1-(1,4-oxathian-2-yl)pentan-1-amine?
The IUPAC name of N,3-diethyl-1-(1,4-oxathian-2-yl)pentan-1-amine (CID 82922082) is N,3-diethyl-1-(1,4-oxathian-2-yl)pentan-1-amine.
What is the SMILES notation for N,3-diethyl-1-(1,4-oxathian-2-yl)pentan-1-amine?
The canonical SMILES for N,3-diethyl-1-(1,4-oxathian-2-yl)pentan-1-amine is CCNC(CC(CC)CC)C1CSCCO1.
What is the InChIKey of N,3-diethyl-1-(1,4-oxathian-2-yl)pentan-1-amine?
The InChIKey is HODVPYCFCCBFJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NOS/c1-4-11(5-2)9-12(14-6-3)13-10-16-8-7-15-13/h11-14H,4-10H2,1-3H3.
What are the key properties of N,3-diethyl-1-(1,4-oxathian-2-yl)pentan-1-amine?
N,3-diethyl-1-(1,4-oxathian-2-yl)pentan-1-amine has a molecular weight of 245.43 g/mol, XLogP of 2.92, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,3-diethyl-1-(1,4-oxathian-2-yl)pentan-1-amine is sourced from PubChem (CID 82922082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).