C15H31NOS — CID 79962851
N,3-diethyl-1-(1,4-oxathian-2-yl)heptan-1-amine (PubChem CID 79962851) has the molecular formula C15H31NOS and a molecular weight of 273.49 g/mol. Its IUPAC name is N,3-diethyl-1-(1,4-oxathian-2-yl)heptan-1-amine.
| Compound Name | N,3-diethyl-1-(1,4-oxathian-2-yl)heptan-1-amine |
|---|---|
| PubChem CID | 79962851 |
| Molecular Formula | C15H31NOS |
| Molecular Weight | 273.49 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | N,3-diethyl-1-(1,4-oxathian-2-yl)heptan-1-amine |
| SMILES | CCCCC(CC)CC(NCC)C1CSCCO1 |
| InChI | InChI=1S/C15H31NOS/c1-4-7-8-13(5-2)11-14(16-6-3)15-12-18-10-9-17-15/h13-16H,4-12H2,1-3H3 |
| InChIKey | BTVLRFKFQIHZGU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |