C14H29NOS — CID 79963234
3-ethyl-N-methyl-1-(1,4-oxathian-2-yl)heptan-1-amine (PubChem CID 79963234) has the molecular formula C14H29NOS and a molecular weight of 259.46 g/mol. Its IUPAC name is 3-ethyl-N-methyl-1-(1,4-oxathian-2-yl)heptan-1-amine.
| Compound Name | 3-ethyl-N-methyl-1-(1,4-oxathian-2-yl)heptan-1-amine |
|---|---|
| PubChem CID | 79963234 |
| Molecular Formula | C14H29NOS |
| Molecular Weight | 259.46 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 3-ethyl-N-methyl-1-(1,4-oxathian-2-yl)heptan-1-amine |
| SMILES | CCCCC(CC)CC(NC)C1CSCCO1 |
| InChI | InChI=1S/C14H29NOS/c1-4-6-7-12(5-2)10-13(15-3)14-11-17-9-8-16-14/h12-15H,4-11H2,1-3H3 |
| InChIKey | XJZHFBUHTZXYOI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |