C11H23NOS — CID 79962336
N-methyl-1-(1,4-oxathian-2-yl)hexan-1-amine (PubChem CID 79962336) has the molecular formula C11H23NOS and a molecular weight of 217.38 g/mol. Its IUPAC name is N-methyl-1-(1,4-oxathian-2-yl)hexan-1-amine.
| Compound Name | N-methyl-1-(1,4-oxathian-2-yl)hexan-1-amine |
|---|---|
| PubChem CID | 79962336 |
| Molecular Formula | C11H23NOS |
| Molecular Weight | 217.38 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | N-methyl-1-(1,4-oxathian-2-yl)hexan-1-amine |
| SMILES | CCCCCC(NC)C1CSCCO1 |
| InChI | InChI=1S/C11H23NOS/c1-3-4-5-6-10(12-2)11-9-14-8-7-13-11/h10-12H,3-9H2,1-2H3 |
| InChIKey | XPWXLMFBHZQWQW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|